C18H23FN4O — CID 59011507
(3aR,4R,6aS)-2-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 59011507) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is (3aR,4R,6aS)-2-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4R,6aS)-2-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 59011507 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3aR,4R,6aS)-2-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | COc1ccc2ncc(F)c(CCN3C[C@H]4CC[C@@H](N)[C@H]4C3)c2n1 |
| InChI | InChI=1S/C18H23FN4O/c1-24-17-5-4-16-18(22-17)12(14(19)8-21-16)6-7-23-9-11-2-3-15(20)13(11)10-23/h4-5,8,11,13,15H,2-3,6-7,9-10,20H2,1H3/t11-,13+,15-/m1/s1 |
| InChIKey | RRBNIAAUZDRTQM-OSAQELSMSA-N |
| XLogP | 1.99 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |