C20H21N5O3S — CID 59011532
2-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethoxy]ethanol (PubChem CID 59011532) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is 2-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 59011532 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethoxy]ethanol |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCOCCO)n2)c1 |
| InChI | InChI=1S/C20H21N5O3S/c1-27-15-4-2-3-14(13-15)17-18(25-8-12-29-20(25)24-17)16-5-6-21-19(23-16)22-7-10-28-11-9-26/h2-6,8,12-13,26H,7,9-11H2,1H3,(H,21,22,23) |
| InChIKey | QZEISOPBFDGXMJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|