About 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal
7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal (PubChem CID 59012143) has the molecular formula C15H30O3Si
and a molecular weight of 286.49 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal.
Molecular Properties
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal |
| PubChem CID | 59012143 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal |
| SMILES | CC(C)(CO[Si](C)(C)C(C)(C)C)C(=O)CCCC=O |
| InChI | InChI=1S/C15H30O3Si/c1-14(2,3)19(6,7)18-12-15(4,5)13(17)10-8-9-11-16/h11H,8-10,12H2,1-7H3 |
| InChIKey | VUQBYYNJHMFKMO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal?
The IUPAC name of 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal (CID 59012143) is 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal.
What is the SMILES notation for 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal?
The canonical SMILES for 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal is CC(C)(CO[Si](C)(C)C(C)(C)C)C(=O)CCCC=O.
What is the InChIKey of 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal?
The InChIKey is VUQBYYNJHMFKMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3Si/c1-14(2,3)19(6,7)18-12-15(4,5)13(17)10-8-9-11-16/h11H,8-10,12H2,1-7H3.
What are the key properties of 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal?
7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal has a molecular weight of 286.49 g/mol, XLogP of 3.97, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5-oxoheptanal is sourced from PubChem (CID 59012143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).