C32H56O9Si — CID 59012161
[(2S,3S,4E,6S)-6-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate (PubChem CID 59012161) has the molecular formula C32H56O9Si and a molecular weight of 612.88 g/mol. Its IUPAC name is [(2S,3S,4E,6S)-6-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4E,6S)-6-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 59012161 |
| Molecular Formula | C32H56O9Si |
| Molecular Weight | 612.88 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | [(2S,3S,4E,6S)-6-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1/C(=C/C(=O)OC)C[C@@H](C[C@@H](O)CO[Si](C)(C)C(C)(C)C)O[C@@]1(OC)C(C)(C)/C=C/C=O |
| InChI | InChI=1S/C32H56O9Si/c1-11-12-13-14-15-17-27(35)40-29-24(21-28(36)37-7)20-26(22-25(34)23-39-42(9,10)30(2,3)4)41-32(29,38-8)31(5,6)18-16-19-33/h16,18-19,21,25-26,29,34H,11-15,17,20,22-23H2,1-10H3/b18-16+,24-21+/t25-,26+,29+,32-/m1/s1 |
| InChIKey | ODOSCJJLQLCMLR-GYASSDCASA-N |
| XLogP | 6.04 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.88 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|