C38H35FN2O4S2 — CID 59012245
[(E)-[[9-ethyl-6-[4-(2-ethyl-2,5-dimethyl-1,3-dithiolane-4-carbonyl)-2-fluorobenzoyl]carbazol-3-yl]-phenylmethylidene]amino] acetate (PubChem CID 59012245) has the molecular formula C38H35FN2O4S2 and a molecular weight of 666.84 g/mol. Its IUPAC name is [(E)-[[9-ethyl-6-[4-(2-ethyl-2,5-dimethyl-1,3-dithiolane-4-carbonyl)-2-fluorobenzoyl]carbazol-3-yl]-phenylmethylidene]amino] acetate.
| Compound Name | [(E)-[[9-ethyl-6-[4-(2-ethyl-2,5-dimethyl-1,3-dithiolane-4-carbonyl)-2-fluorobenzoyl]carbazol-3-yl]-phenylmethylidene]amino] acetate |
|---|---|
| PubChem CID | 59012245 |
| Molecular Formula | C38H35FN2O4S2 |
| Molecular Weight | 666.84 g/mol |
| Exact Mass | 666.20 |
| IUPAC Name | [(E)-[[9-ethyl-6-[4-(2-ethyl-2,5-dimethyl-1,3-dithiolane-4-carbonyl)-2-fluorobenzoyl]carbazol-3-yl]-phenylmethylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3ccc(C(=O)C4SC(C)(CC)SC4C)cc3F)cc2c2cc(/C(=N/OC(C)=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C38H35FN2O4S2/c1-6-38(5)46-22(3)37(47-38)36(44)27-13-16-28(31(39)21-27)35(43)26-15-18-33-30(20-26)29-19-25(14-17-32(29)41(33)7-2)34(40-45-23(4)42)24-11-9-8-10-12-24/h8-22,37H,6-7H2,1-5H3/b40-34+ |
| InChIKey | JJXRSEMPMOQSOT-QZQBIAJISA-N |
| XLogP | 9.05 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.84 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|