C36H30ClFN2O4S2 — CID 59012246
[(E)-[[6-[4-(2-chloro-2,5-dimethyl-1,3-dithiolane-4-carbonyl)-2-fluorobenzoyl]-9-ethylcarbazol-3-yl]-phenylmethylidene]amino] acetate (PubChem CID 59012246) has the molecular formula C36H30ClFN2O4S2 and a molecular weight of 673.23 g/mol. Its IUPAC name is [(E)-[[6-[4-(2-chloro-2,5-dimethyl-1,3-dithiolane-4-carbonyl)-2-fluorobenzoyl]-9-ethylcarbazol-3-yl]-phenylmethylidene]amino] acetate.
| Compound Name | [(E)-[[6-[4-(2-chloro-2,5-dimethyl-1,3-dithiolane-4-carbonyl)-2-fluorobenzoyl]-9-ethylcarbazol-3-yl]-phenylmethylidene]amino] acetate |
|---|---|
| PubChem CID | 59012246 |
| Molecular Formula | C36H30ClFN2O4S2 |
| Molecular Weight | 673.23 g/mol |
| Exact Mass | 672.13 |
| IUPAC Name | [(E)-[[6-[4-(2-chloro-2,5-dimethyl-1,3-dithiolane-4-carbonyl)-2-fluorobenzoyl]-9-ethylcarbazol-3-yl]-phenylmethylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3ccc(C(=O)C4SC(C)(Cl)SC4C)cc3F)cc2c2cc(/C(=N/OC(C)=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C36H30ClFN2O4S2/c1-5-40-30-15-12-23(32(39-44-21(3)41)22-9-7-6-8-10-22)17-27(30)28-18-24(13-16-31(28)40)33(42)26-14-11-25(19-29(26)38)34(43)35-20(2)45-36(4,37)46-35/h6-20,35H,5H2,1-4H3/b39-32+ |
| InChIKey | UCAUACOTRURTDB-LETMKSKHSA-N |
| XLogP | 8.83 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.23 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|