C36H34N2O5 — CID 59012256
[(E)-[[6-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]benzoyl]-9-methylcarbazol-3-yl]-phenylmethylidene]amino] acetate (PubChem CID 59012256) has the molecular formula C36H34N2O5 and a molecular weight of 574.68 g/mol. Its IUPAC name is [(E)-[[6-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]benzoyl]-9-methylcarbazol-3-yl]-phenylmethylidene]amino] acetate.
| Compound Name | [(E)-[[6-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]benzoyl]-9-methylcarbazol-3-yl]-phenylmethylidene]amino] acetate |
|---|---|
| PubChem CID | 59012256 |
| Molecular Formula | C36H34N2O5 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | [(E)-[[6-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]benzoyl]-9-methylcarbazol-3-yl]-phenylmethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\c1ccccc1)c1ccc2c(c1)c1cc(C(=O)c3ccc(CCC4COC(C)(C)O4)cc3)ccc1n2C |
| InChI | InChI=1S/C36H34N2O5/c1-23(39)43-37-34(25-8-6-5-7-9-25)27-15-18-32-30(20-27)31-21-28(16-19-33(31)38(32)4)35(40)26-13-10-24(11-14-26)12-17-29-22-41-36(2,3)42-29/h5-11,13-16,18-21,29H,12,17,22H2,1-4H3/b37-34+ |
| InChIKey | XUJMQAUXWJTCBV-NFSLGCCLSA-N |
| XLogP | 6.96 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|