C17H23FO6 — CID 59012613
(4aR,6R,7R,8S,8aR)-8-(ethoxymethoxy)-7-fluoro-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 59012613) has the molecular formula C17H23FO6 and a molecular weight of 342.36 g/mol. Its IUPAC name is (4aR,6R,7R,8S,8aR)-8-(ethoxymethoxy)-7-fluoro-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,7R,8S,8aR)-8-(ethoxymethoxy)-7-fluoro-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 59012613 |
| Molecular Formula | C17H23FO6 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (4aR,6R,7R,8S,8aR)-8-(ethoxymethoxy)-7-fluoro-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCOCO[C@@H]1[C@@H](F)[C@H](OC)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C17H23FO6/c1-3-20-10-22-15-13(18)17(19-2)23-12-9-21-16(24-14(12)15)11-7-5-4-6-8-11/h4-8,12-17H,3,9-10H2,1-2H3/t12-,13-,14-,15-,16?,17-/m1/s1 |
| InChIKey | NADOOLZCNNIFJX-CTEFGONOSA-N |
| XLogP | 2.19 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|