About 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran
3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran (PubChem CID 59012651) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran.
Analyze 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran?
The IUPAC name of 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran (CID 59012651) is 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran.
What is the SMILES notation for 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran?
The canonical SMILES for 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran is CC1CCC2=C(C1)OCC2C.
What is the InChIKey of 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran?
The InChIKey is MWDYPMOYPUCEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-7-3-4-9-8(2)6-11-10(9)5-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran?
3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran has a molecular weight of 152.24 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-2,3,4,5,6,7-hexahydro-1-benzofuran is sourced from PubChem (CID 59012651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).