C18H30O — CID 59012672
2,2,3,5,5-pentamethyl-4-(2,4,5,5-tetramethylcyclopenten-1-yl)furan (PubChem CID 59012672) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 2,2,3,5,5-pentamethyl-4-(2,4,5,5-tetramethylcyclopenten-1-yl)furan.
| Compound Name | 2,2,3,5,5-pentamethyl-4-(2,4,5,5-tetramethylcyclopenten-1-yl)furan |
|---|---|
| PubChem CID | 59012672 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 2,2,3,5,5-pentamethyl-4-(2,4,5,5-tetramethylcyclopenten-1-yl)furan |
| SMILES | CC1=C(C2=C(C)C(C)(C)OC2(C)C)C(C)(C)C(C)C1 |
| InChI | InChI=1S/C18H30O/c1-11-10-12(2)16(4,5)14(11)15-13(3)17(6,7)19-18(15,8)9/h12H,10H2,1-9H3 |
| InChIKey | XIHXGQKVGUQKDS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |