C15H26O2 — CID 59012708
1-(2,2,4,4,5,6a-hexamethyl-3,3a,5,6-tetrahydrocyclopenta[b]furan-3-yl)ethanone (PubChem CID 59012708) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-(2,2,4,4,5,6a-hexamethyl-3,3a,5,6-tetrahydrocyclopenta[b]furan-3-yl)ethanone.
| Compound Name | 1-(2,2,4,4,5,6a-hexamethyl-3,3a,5,6-tetrahydrocyclopenta[b]furan-3-yl)ethanone |
|---|---|
| PubChem CID | 59012708 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1-(2,2,4,4,5,6a-hexamethyl-3,3a,5,6-tetrahydrocyclopenta[b]furan-3-yl)ethanone |
| SMILES | CC(=O)C1C2C(C)(CC(C)C2(C)C)OC1(C)C |
| InChI | InChI=1S/C15H26O2/c1-9-8-15(7)12(13(9,3)4)11(10(2)16)14(5,6)17-15/h9,11-12H,8H2,1-7H3 |
| InChIKey | AAYYZVKMCQSDKG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |