C13H20F7NO2 — CID 59012961
4-[2-(4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl)oxyethyl]morpholine (PubChem CID 59012961) has the molecular formula C13H20F7NO2 and a molecular weight of 355.29 g/mol. Its IUPAC name is 4-[2-(4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl)oxyethyl]morpholine.
| Compound Name | 4-[2-(4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl)oxyethyl]morpholine |
|---|---|
| PubChem CID | 59012961 |
| Molecular Formula | C13H20F7NO2 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-[2-(4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl)oxyethyl]morpholine |
| SMILES | CC(C)C(OCCN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H20F7NO2/c1-9(2)10(11(14,15)12(16,17)13(18,19)20)23-8-5-21-3-6-22-7-4-21/h9-10H,3-8H2,1-2H3 |
| InChIKey | HEGIZJPLXSVBKX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|