C11H15F8NO2 — CID 59012971
4-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]morpholine (PubChem CID 59012971) has the molecular formula C11H15F8NO2 and a molecular weight of 345.23 g/mol. Its IUPAC name is 4-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]morpholine.
| Compound Name | 4-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]morpholine |
|---|---|
| PubChem CID | 59012971 |
| Molecular Formula | C11H15F8NO2 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]morpholine |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COCCN1CCOCC1 |
| InChI | InChI=1S/C11H15F8NO2/c12-8(13)10(16,17)11(18,19)9(14,15)7-22-6-3-20-1-4-21-5-2-20/h8H,1-7H2 |
| InChIKey | GJPWNVCXJKYCQP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|