C14H21F8NO2 — CID 59013013
4-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]morpholine (PubChem CID 59013013) has the molecular formula C14H21F8NO2 and a molecular weight of 387.31 g/mol. Its IUPAC name is 4-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]morpholine.
| Compound Name | 4-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]morpholine |
|---|---|
| PubChem CID | 59013013 |
| Molecular Formula | C14H21F8NO2 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]morpholine |
| SMILES | CC(C)C(OCCN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H21F8NO2/c1-9(2)10(25-8-5-23-3-6-24-7-4-23)12(17,18)14(21,22)13(19,20)11(15)16/h9-11H,3-8H2,1-2H3 |
| InChIKey | QJSBOSIOTAYJHZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|