About ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate
ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate (PubChem CID 59014344) has the molecular formula C10H11N3O3
and a molecular weight of 221.22 g/mol. Its IUPAC name is ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate |
| PubChem CID | 59014344 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate |
| SMILES | CCOC(=O)Cn1cnc2cc[nH]c(=O)c21 |
| InChI | InChI=1S/C10H11N3O3/c1-2-16-8(14)5-13-6-12-7-3-4-11-10(15)9(7)13/h3-4,6H,2,5H2,1H3,(H,11,15) |
| InChIKey | ZKKYOQFWZCVCBQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate?
The IUPAC name of ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate (CID 59014344) is ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate.
What is the SMILES notation for ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate?
The canonical SMILES for ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate is CCOC(=O)Cn1cnc2cc[nH]c(=O)c21.
What is the InChIKey of ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate?
The InChIKey is ZKKYOQFWZCVCBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O3/c1-2-16-8(14)5-13-6-12-7-3-4-11-10(15)9(7)13/h3-4,6H,2,5H2,1H3,(H,11,15).
What are the key properties of ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate?
ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate has a molecular weight of 221.22 g/mol, XLogP of 0.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-oxo-5H-imidazo[4,5-c]pyridin-3-yl)acetate is sourced from PubChem (CID 59014344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).