About methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate
methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate (PubChem CID 59014363) has the molecular formula C10H13N3O3
and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate |
| PubChem CID | 59014363 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate |
| SMILES | COC(=O)Cn1ncc2c1C=CN(C)C2O |
| InChI | InChI=1S/C10H13N3O3/c1-12-4-3-8-7(10(12)15)5-11-13(8)6-9(14)16-2/h3-5,10,15H,6H2,1-2H3 |
| InChIKey | GPKYLUQJKUSVOE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate?
The IUPAC name of methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate (CID 59014363) is methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate.
What is the SMILES notation for methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate?
The canonical SMILES for methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate is COC(=O)Cn1ncc2c1C=CN(C)C2O.
What is the InChIKey of methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate?
The InChIKey is GPKYLUQJKUSVOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O3/c1-12-4-3-8-7(10(12)15)5-11-13(8)6-9(14)16-2/h3-5,10,15H,6H2,1-2H3.
What are the key properties of methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate?
methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate has a molecular weight of 223.23 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-hydroxy-5-methyl-4H-pyrazolo[4,5-c]pyridin-1-yl)acetate is sourced from PubChem (CID 59014363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).