About 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane
2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane (PubChem CID 59014481) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane |
| PubChem CID | 59014481 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane |
| SMILES | [CH2-][NH+]1CCSC2(CC[NH+]([CH2-])C2)C1 |
| InChI | InChI=1S/C9H18N2S/c1-10-4-3-9(7-10)8-11(2)5-6-12-9/h10-11H,1-8H2 |
| InChIKey | RARDIOXJXXBWMI-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane?
The IUPAC name of 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane (CID 59014481) is 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane.
What is the SMILES notation for 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane?
The canonical SMILES for 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane is [CH2-][NH+]1CCSC2(CC[NH+]([CH2-])C2)C1.
What is the InChIKey of 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane?
The InChIKey is RARDIOXJXXBWMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S/c1-10-4-3-9(7-10)8-11(2)5-6-12-9/h10-11H,1-8H2.
What are the key properties of 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane?
2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane has a molecular weight of 186.32 g/mol, XLogP of -1.77, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dimethanidyl-6-thia-2,9-diazoniaspiro[4.5]decane is sourced from PubChem (CID 59014481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).