C21H21ClN2O2 — CID 59014594
3-chloro-4-methoxy-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)benzamide (PubChem CID 59014594) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)benzamide.
| Compound Name | 3-chloro-4-methoxy-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)benzamide |
|---|---|
| PubChem CID | 59014594 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-chloro-4-methoxy-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)benzamide |
| SMILES | COc1ccc(C(=O)NC2CCCc3c2[nH]c2ccc(C)cc32)cc1Cl |
| InChI | InChI=1S/C21H21ClN2O2/c1-12-6-8-17-15(10-12)14-4-3-5-18(20(14)23-17)24-21(25)13-7-9-19(26-2)16(22)11-13/h6-11,18,23H,3-5H2,1-2H3,(H,24,25) |
| InChIKey | DWFONWLINXKEEF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|