C22H31N3O — CID 59014682
8-(cyclohexylamino)-N-ethyl-N-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 59014682) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 8-(cyclohexylamino)-N-ethyl-N-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | 8-(cyclohexylamino)-N-ethyl-N-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 59014682 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 8-(cyclohexylamino)-N-ethyl-N-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | CCN(C)C(=O)c1ccc2[nH]c3c(c2c1)CCCC3NC1CCCCC1 |
| InChI | InChI=1S/C22H31N3O/c1-3-25(2)22(26)15-12-13-19-18(14-15)17-10-7-11-20(21(17)24-19)23-16-8-5-4-6-9-16/h12-14,16,20,23-24H,3-11H2,1-2H3 |
| InChIKey | XETKSNUPTQQATF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|