About trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile
trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile (PubChem CID 59015212) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile.
Molecular Properties
| Compound Name | trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile |
| PubChem CID | 59015212 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile |
| SMILES | CC1(C)CC1CC[C@@]1(C)C[C@H]1C#N |
| InChI | InChI=1S/C12H19N/c1-11(2)6-9(11)4-5-12(3)7-10(12)8-13/h9-10H,4-7H2,1-3H3/t9?,10-,12-/m0/s1 |
| InChIKey | CSUDPNFGBXTWQB-CIZBPJNJSA-N |
| XLogP | 3.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile?
The IUPAC name of trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile (CID 59015212) is trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile.
What is the SMILES notation for trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile?
The canonical SMILES for trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile is CC1(C)CC1CC[C@@]1(C)C[C@H]1C#N.
What is the InChIKey of trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile?
The InChIKey is CSUDPNFGBXTWQB-CIZBPJNJSA-N. The full InChI is InChI=1S/C12H19N/c1-11(2)6-9(11)4-5-12(3)7-10(12)8-13/h9-10H,4-7H2,1-3H3/t9?,10-,12-/m0/s1.
What are the key properties of trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile?
trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile has a molecular weight of 177.29 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-2-[2-(2,2-dimethylcyclopropyl)ethyl]-2-methylcyclopropane-1-carbonitrile is sourced from PubChem (CID 59015212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).