About 5-nitrothieno[3,2-b]thiophene
5-nitrothieno[3,2-b]thiophene (PubChem CID 59015268) has the molecular formula C6H3NO2S2
and a molecular weight of 185.23 g/mol. Its IUPAC name is 5-nitrothieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 5-nitrothieno[3,2-b]thiophene |
| PubChem CID | 59015268 |
| Molecular Formula | C6H3NO2S2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 184.96 |
| IUPAC Name | 5-nitrothieno[3,2-b]thiophene |
| SMILES | O=[N+]([O-])c1cc2sccc2s1 |
| InChI | InChI=1S/C6H3NO2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H |
| InChIKey | MRAWYNDPWTUYSJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrothieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrothieno[3,2-b]thiophene?
The IUPAC name of 5-nitrothieno[3,2-b]thiophene (CID 59015268) is 5-nitrothieno[3,2-b]thiophene.
What is the SMILES notation for 5-nitrothieno[3,2-b]thiophene?
The canonical SMILES for 5-nitrothieno[3,2-b]thiophene is O=[N+]([O-])c1cc2sccc2s1.
What is the InChIKey of 5-nitrothieno[3,2-b]thiophene?
The InChIKey is MRAWYNDPWTUYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3NO2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H.
What are the key properties of 5-nitrothieno[3,2-b]thiophene?
5-nitrothieno[3,2-b]thiophene has a molecular weight of 185.23 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrothieno[3,2-b]thiophene is sourced from PubChem (CID 59015268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).