About iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine
iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine (PubChem CID 59015418) has the molecular formula C25H17IrN2O2-
and a molecular weight of 569.64 g/mol. Its IUPAC name is iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine.
Molecular Properties
| Compound Name | iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine |
| PubChem CID | 59015418 |
| Molecular Formula | C25H17IrN2O2- |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine |
| SMILES | O=C(O)c1nc2ccccc2c2ccccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C14H9NO2.C11H8N.Ir/c16-14(17)13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)15-13;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8H,(H,16,17);1-6,8-9H;/q;-1; |
| InChIKey | WAQAXQKYAPVKTD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine?
The IUPAC name of iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine (CID 59015418) is iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine.
What is the SMILES notation for iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine?
The canonical SMILES for iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine is O=C(O)c1nc2ccccc2c2ccccc12.[Ir].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine?
The InChIKey is WAQAXQKYAPVKTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO2.C11H8N.Ir/c16-14(17)13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)15-13;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8H,(H,16,17);1-6,8-9H;/q;-1;.
What are the key properties of iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine?
iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine has a molecular weight of 569.64 g/mol, XLogP of 5.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;phenanthridine-6-carboxylic acid;2-phenylpyridine is sourced from PubChem (CID 59015418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).