C8H15N — CID 59015747
1,4-dimethyl-2,3,4,7-tetrahydroazepine (PubChem CID 59015747) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is 1,4-dimethyl-2,3,4,7-tetrahydroazepine.
| Compound Name | 1,4-dimethyl-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 59015747 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 1,4-dimethyl-2,3,4,7-tetrahydroazepine |
| SMILES | CC1C=CCN(C)CC1 |
| InChI | InChI=1S/C8H15N/c1-8-4-3-6-9(2)7-5-8/h3-4,8H,5-7H2,1-2H3 |
| InChIKey | VYVXAPYOJFBIRU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|