About 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide
6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide (PubChem CID 59016559) has the molecular formula C19H15IN4O2
and a molecular weight of 458.26 g/mol. Its IUPAC name is 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
| PubChem CID | 59016559 |
| Molecular Formula | C19H15IN4O2 |
| Molecular Weight | 458.26 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccccc2)c2c1CCN(c1ccc(I)cc1)C2=O |
| InChI | InChI=1S/C19H15IN4O2/c20-12-6-8-13(9-7-12)23-11-10-15-16(18(21)25)22-24(17(15)19(23)26)14-4-2-1-3-5-14/h1-9H,10-11H2,(H2,21,25) |
| InChIKey | MIBSNEHCJLRDKV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide?
The IUPAC name of 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide (CID 59016559) is 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide.
What is the SMILES notation for 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide?
The canonical SMILES for 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide is NC(=O)c1nn(-c2ccccc2)c2c1CCN(c1ccc(I)cc1)C2=O.
What is the InChIKey of 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide?
The InChIKey is MIBSNEHCJLRDKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15IN4O2/c20-12-6-8-13(9-7-12)23-11-10-15-16(18(21)25)22-24(17(15)19(23)26)14-4-2-1-3-5-14/h1-9H,10-11H2,(H2,21,25).
What are the key properties of 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide?
6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide has a molecular weight of 458.26 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-iodophenyl)-7-oxo-1-phenyl-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide is sourced from PubChem (CID 59016559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).