C26H40O3 — CID 59016861
methyl (7E)-7-[(1S,2S,3S,6S,7R)-3-octyl-5-oxo-4-tricyclo[5.2.1.02,6]dec-8-enylidene]heptanoate (PubChem CID 59016861) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is methyl (7E)-7-[(1S,2S,3S,6S,7R)-3-octyl-5-oxo-4-tricyclo[5.2.1.02,6]dec-8-enylidene]heptanoate.
| Compound Name | methyl (7E)-7-[(1S,2S,3S,6S,7R)-3-octyl-5-oxo-4-tricyclo[5.2.1.02,6]dec-8-enylidene]heptanoate |
|---|---|
| PubChem CID | 59016861 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | methyl (7E)-7-[(1S,2S,3S,6S,7R)-3-octyl-5-oxo-4-tricyclo[5.2.1.02,6]dec-8-enylidene]heptanoate |
| SMILES | CCCCCCCC[C@@H]1/C(=C\CCCCCC(=O)OC)C(=O)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C26H40O3/c1-3-4-5-6-7-10-13-21-22(14-11-8-9-12-15-23(27)29-2)26(28)25-20-17-16-19(18-20)24(21)25/h14,16-17,19-21,24-25H,3-13,15,18H2,1-2H3/b22-14+/t19-,20+,21-,24+,25+/m1/s1 |
| InChIKey | VUXULLVWBMUKCK-UOGUXRJESA-N |
| XLogP | 6.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|