C13H20OSi — CID 59016862
(1R,2S,6R,7S)-4-trimethylsilyltricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 59016862) has the molecular formula C13H20OSi and a molecular weight of 220.39 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-trimethylsilyltricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2S,6R,7S)-4-trimethylsilyltricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 59016862 |
| Molecular Formula | C13H20OSi |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (1R,2S,6R,7S)-4-trimethylsilyltricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | C[Si](C)(C)C1C[C@H]2[C@@H](C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C13H20OSi/c1-15(2,3)11-7-10-8-4-5-9(6-8)12(10)13(11)14/h4-5,8-12H,6-7H2,1-3H3/t8-,9+,10-,11?,12+/m1/s1 |
| InChIKey | FELLVJIKYBVTTB-NVFWCSOASA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|