About 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate
2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59017051) has the molecular formula C12H17Cl3O4Si
and a molecular weight of 359.71 g/mol. Its IUPAC name is 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 59017051 |
| Molecular Formula | C12H17Cl3O4Si |
| Molecular Weight | 359.71 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(=O)OCCOC(=O)C1CC2CC1C([Si](Cl)(Cl)Cl)C2 |
| InChI | InChI=1S/C12H17Cl3O4Si/c1-7(16)18-2-3-19-12(17)10-5-8-4-9(10)11(6-8)20(13,14)15/h8-11H,2-6H2,1H3 |
| InChIKey | YUUPRXRXOKRRGI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.71 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate (CID 59017051) is 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate is CC(=O)OCCOC(=O)C1CC2CC1C([Si](Cl)(Cl)Cl)C2.
What is the InChIKey of 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is YUUPRXRXOKRRGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl3O4Si/c1-7(16)18-2-3-19-12(17)10-5-8-4-9(10)11(6-8)20(13,14)15/h8-11H,2-6H2,1H3.
What are the key properties of 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate?
2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 359.71 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl 6-trichlorosilylbicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 59017051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).