C12H24O4 — CID 59017146
2-(1,2-diethoxyethyl)-2-(ethoxymethyl)oxetane (PubChem CID 59017146) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-(1,2-diethoxyethyl)-2-(ethoxymethyl)oxetane.
| Compound Name | 2-(1,2-diethoxyethyl)-2-(ethoxymethyl)oxetane |
|---|---|
| PubChem CID | 59017146 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-(1,2-diethoxyethyl)-2-(ethoxymethyl)oxetane |
| SMILES | CCOCC(OCC)C1(COCC)CCO1 |
| InChI | InChI=1S/C12H24O4/c1-4-13-9-11(15-6-3)12(7-8-16-12)10-14-5-2/h11H,4-10H2,1-3H3 |
| InChIKey | XYMPSFLNXZUNEG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |