C11H15N2OW- — CID 59017605
3-ethyl-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;tungsten (PubChem CID 59017605) has the molecular formula C11H15N2OW- and a molecular weight of 375.09 g/mol. Its IUPAC name is 3-ethyl-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;tungsten.
| Compound Name | 3-ethyl-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;tungsten |
|---|---|
| PubChem CID | 59017605 |
| Molecular Formula | C11H15N2OW- |
| Molecular Weight | 375.09 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 3-ethyl-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;tungsten |
| SMILES | [CH2-]Cc1c(C)nc2n(c1=O)CCCC2.[W] |
| InChI | InChI=1S/C11H15N2O.W/c1-3-9-8(2)12-10-6-4-5-7-13(10)11(9)14;/h1,3-7H2,2H3;/q-1; |
| InChIKey | PDKUIZNFTGCLRJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.09 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|