C20H20F12O5S — CID 59017669
4-[6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-5-methyl-6-oxohexan-3-yl]benzenesulfonic acid (PubChem CID 59017669) has the molecular formula C20H20F12O5S and a molecular weight of 600.42 g/mol. Its IUPAC name is 4-[6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-5-methyl-6-oxohexan-3-yl]benzenesulfonic acid.
| Compound Name | 4-[6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-5-methyl-6-oxohexan-3-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59017669 |
| Molecular Formula | C20H20F12O5S |
| Molecular Weight | 600.42 g/mol |
| Exact Mass | 600.08 |
| IUPAC Name | 4-[6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-5-methyl-6-oxohexan-3-yl]benzenesulfonic acid |
| SMILES | CCC(CC(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H20F12O5S/c1-3-11(12-4-6-13(7-5-12)38(34,35)36)8-10(2)14(33)37-9-16(23,24)18(27,28)20(31,32)19(29,30)17(25,26)15(21)22/h4-7,10-11,15H,3,8-9H2,1-2H3,(H,34,35,36) |
| InChIKey | CXOFPMGFNXTDNN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.42 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|