C19H22F12O6 — CID 59017679
3-[5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-ethyl-4,4-dimethyl-5-oxopentanoyl]oxypropanoic acid (PubChem CID 59017679) has the molecular formula C19H22F12O6 and a molecular weight of 574.36 g/mol. Its IUPAC name is 3-[5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-ethyl-4,4-dimethyl-5-oxopentanoyl]oxypropanoic acid.
| Compound Name | 3-[5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-ethyl-4,4-dimethyl-5-oxopentanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 59017679 |
| Molecular Formula | C19H22F12O6 |
| Molecular Weight | 574.36 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | 3-[5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-ethyl-4,4-dimethyl-5-oxopentanoyl]oxypropanoic acid |
| SMILES | CCC(CC(C)(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)OCCC(=O)O |
| InChI | InChI=1S/C19H22F12O6/c1-4-9(11(34)36-6-5-10(32)33)7-14(2,3)13(35)37-8-15(22,23)17(26,27)19(30,31)18(28,29)16(24,25)12(20)21/h9,12H,4-8H2,1-3H3,(H,32,33) |
| InChIKey | XXOHLQSYXUGCHH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.36 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|