C26H36F12O7 — CID 59017698
4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-2-[2-(2-hydroxyethoxycarbonyl)-2-methylbutyl]-4,6,6-trimethylheptanoic acid (PubChem CID 59017698) has the molecular formula C26H36F12O7 and a molecular weight of 688.54 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-2-[2-(2-hydroxyethoxycarbonyl)-2-methylbutyl]-4,6,6-trimethylheptanoic acid.
| Compound Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-2-[2-(2-hydroxyethoxycarbonyl)-2-methylbutyl]-4,6,6-trimethylheptanoic acid |
|---|---|
| PubChem CID | 59017698 |
| Molecular Formula | C26H36F12O7 |
| Molecular Weight | 688.54 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-2-[2-(2-hydroxyethoxycarbonyl)-2-methylbutyl]-4,6,6-trimethylheptanoic acid |
| SMILES | CCC(C)(CC(CC(C)(CC(C)(C)C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)O)C(=O)OCCO |
| InChI | InChI=1S/C26H36F12O7/c1-7-20(5,17(42)44-9-8-39)10-14(15(40)41)11-21(6,12-19(2,3)4)18(43)45-13-22(29,30)24(33,34)26(37,38)25(35,36)23(31,32)16(27)28/h14,16,39H,7-13H2,1-6H3,(H,40,41) |
| InChIKey | MJTZIKNDBYTMMG-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|