C17H20F12O4 — CID 59017708
5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-ethyl-2,4,4-trimethyl-5-oxopentanoic acid (PubChem CID 59017708) has the molecular formula C17H20F12O4 and a molecular weight of 516.32 g/mol. Its IUPAC name is 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-ethyl-2,4,4-trimethyl-5-oxopentanoic acid.
| Compound Name | 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-ethyl-2,4,4-trimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 59017708 |
| Molecular Formula | C17H20F12O4 |
| Molecular Weight | 516.32 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2-ethyl-2,4,4-trimethyl-5-oxopentanoic acid |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C17H20F12O4/c1-5-12(4,9(30)31)6-11(2,3)10(32)33-7-13(20,21)15(24,25)17(28,29)16(26,27)14(22,23)8(18)19/h8H,5-7H2,1-4H3,(H,30,31) |
| InChIKey | OURAJFNEOLXCEK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.32 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|