C15H28O — CID 59018668
2,5,5,7-tetramethyl-2-propan-2-yloct-3-yn-1-ol (PubChem CID 59018668) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 2,5,5,7-tetramethyl-2-propan-2-yloct-3-yn-1-ol.
| Compound Name | 2,5,5,7-tetramethyl-2-propan-2-yloct-3-yn-1-ol |
|---|---|
| PubChem CID | 59018668 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 2,5,5,7-tetramethyl-2-propan-2-yloct-3-yn-1-ol |
| SMILES | CC(C)CC(C)(C)C#CC(C)(CO)C(C)C |
| InChI | InChI=1S/C15H28O/c1-12(2)10-14(5,6)8-9-15(7,11-16)13(3)4/h12-13,16H,10-11H2,1-7H3 |
| InChIKey | RKHUUZDQLSKKIO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|