C16H17F13NO+ — CID 59018766
1-[1-propyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidin-1-ium-1-yl]prop-2-en-1-one (PubChem CID 59018766) has the molecular formula C16H17F13NO+ and a molecular weight of 486.29 g/mol. Its IUPAC name is 1-[1-propyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidin-1-ium-1-yl]prop-2-en-1-one.
| Compound Name | 1-[1-propyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidin-1-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59018766 |
| Molecular Formula | C16H17F13NO+ |
| Molecular Weight | 486.29 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 1-[1-propyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidin-1-ium-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)[N+]1(CCC)CCCC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H17F13NO/c1-3-7-30(10(31)4-2)8-5-6-9(30)11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h4,9H,2-3,5-8H2,1H3/q+1 |
| InChIKey | CGNWIRCTCLCQRP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.29 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|