C8H4F7NO2 — CID 59018811
1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrrole-2,5-dione (PubChem CID 59018811) has the molecular formula C8H4F7NO2 and a molecular weight of 279.11 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 59018811 |
| Molecular Formula | C8H4F7NO2 |
| Molecular Weight | 279.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F7NO2/c9-6(10,7(11,12)8(13,14)15)3-16-4(17)1-2-5(16)18/h1-2H,3H2 |
| InChIKey | CDPVNQPCXUOIHR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.11 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|