C10H13N5O4S — CID 59018913
1-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)pyrrolidine-2-sulfonic acid (PubChem CID 59018913) has the molecular formula C10H13N5O4S and a molecular weight of 299.31 g/mol. Its IUPAC name is 1-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)pyrrolidine-2-sulfonic acid.
| Compound Name | 1-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)pyrrolidine-2-sulfonic acid |
|---|---|
| PubChem CID | 59018913 |
| Molecular Formula | C10H13N5O4S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)pyrrolidine-2-sulfonic acid |
| SMILES | Cc1cc(=O)n2[nH]c(N3CCCC3S(=O)(=O)O)nc2n1 |
| InChI | InChI=1S/C10H13N5O4S/c1-6-5-7(16)15-9(11-6)12-10(13-15)14-4-2-3-8(14)20(17,18)19/h5,8H,2-4H2,1H3,(H,11,12,13)(H,17,18,19) |
| InChIKey | UPAVISKQAFJQSB-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|