About 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine
5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine (PubChem CID 59018916) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine.
Molecular Properties
| Compound Name | 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine |
| PubChem CID | 59018916 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine |
| SMILES | COc1cc(C)nc2nncn12 |
| InChI | InChI=1S/C7H8N4O/c1-5-3-6(12-2)11-4-8-10-7(11)9-5/h3-4H,1-2H3 |
| InChIKey | IHKGRYJWXZVELV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine?
The IUPAC name of 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine (CID 59018916) is 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine.
What is the SMILES notation for 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine?
The canonical SMILES for 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine is COc1cc(C)nc2nncn12.
What is the InChIKey of 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine?
The InChIKey is IHKGRYJWXZVELV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-5-3-6(12-2)11-4-8-10-7(11)9-5/h3-4H,1-2H3.
What are the key properties of 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine?
5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine has a molecular weight of 164.17 g/mol, XLogP of 0.44, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine is sourced from PubChem (CID 59018916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).