About 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol
1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol (PubChem CID 59019093) has the molecular formula C7H14NO+
and a molecular weight of 128.19 g/mol. Its IUPAC name is 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol.
Molecular Properties
| Compound Name | 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol |
| PubChem CID | 59019093 |
| Molecular Formula | C7H14NO+ |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol |
| SMILES | C[N+]1(C)CC=CC(O)C1 |
| InChI | InChI=1S/C7H14NO/c1-8(2)5-3-4-7(9)6-8/h3-4,7,9H,5-6H2,1-2H3/q+1 |
| InChIKey | KMMDFDYXQDVPDW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol?
The IUPAC name of 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol (CID 59019093) is 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol.
What is the SMILES notation for 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol?
The canonical SMILES for 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol is C[N+]1(C)CC=CC(O)C1.
What is the InChIKey of 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol?
The InChIKey is KMMDFDYXQDVPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14NO/c1-8(2)5-3-4-7(9)6-8/h3-4,7,9H,5-6H2,1-2H3/q+1.
What are the key properties of 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol?
1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol has a molecular weight of 128.19 g/mol, XLogP of -0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol is sourced from PubChem (CID 59019093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).