C8H7N3O — CID 59019416
7-isocyano-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine (PubChem CID 59019416) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is 7-isocyano-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine.
| Compound Name | 7-isocyano-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 59019416 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 7-isocyano-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
| SMILES | [C-]#[N+]c1cnc2c(c1)OCCN2 |
| InChI | InChI=1S/C8H7N3O/c1-9-6-4-7-8(11-5-6)10-2-3-12-7/h4-5H,2-3H2,(H,10,11) |
| InChIKey | MOBGDZPLJVDEPH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|