About [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol
[(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol (PubChem CID 59020655) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol |
| PubChem CID | 59020655 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol |
| SMILES | Nc1ccc2c(c1)OC[C@H](CO)N2 |
| InChI | InChI=1S/C9H12N2O2/c10-6-1-2-8-9(3-6)13-5-7(4-12)11-8/h1-3,7,11-12H,4-5,10H2/t7-/m0/s1 |
| InChIKey | UAHNRXBOHAUQEX-ZETCQYMHSA-N |
| XLogP | 0.43 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol?
The IUPAC name of [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol (CID 59020655) is [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol.
What is the SMILES notation for [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol?
The canonical SMILES for [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol is Nc1ccc2c(c1)OC[C@H](CO)N2.
What is the InChIKey of [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol?
The InChIKey is UAHNRXBOHAUQEX-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H12N2O2/c10-6-1-2-8-9(3-6)13-5-7(4-12)11-8/h1-3,7,11-12H,4-5,10H2/t7-/m0/s1.
What are the key properties of [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol?
[(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol has a molecular weight of 180.21 g/mol, XLogP of 0.43, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-7-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol is sourced from PubChem (CID 59020655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).