C9H12N2O2 — CID 59020663
8-amino-2,3,4,5-tetrahydro-1,5-benzoxazepin-3-ol (PubChem CID 59020663) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 8-amino-2,3,4,5-tetrahydro-1,5-benzoxazepin-3-ol.
| Compound Name | 8-amino-2,3,4,5-tetrahydro-1,5-benzoxazepin-3-ol |
|---|---|
| PubChem CID | 59020663 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 8-amino-2,3,4,5-tetrahydro-1,5-benzoxazepin-3-ol |
| SMILES | Nc1ccc2c(c1)OCC(O)CN2 |
| InChI | InChI=1S/C9H12N2O2/c10-6-1-2-8-9(3-6)13-5-7(12)4-11-8/h1-3,7,11-12H,4-5,10H2 |
| InChIKey | ONUATMPYGMHIGW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|