C15H16ClF3N2O4S — CID 59021136
N-[4-chloro-2-[(E)-N-(2-methoxyethoxy)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoro-N-prop-2-ynylmethanesulfonamide (PubChem CID 59021136) has the molecular formula C15H16ClF3N2O4S and a molecular weight of 412.82 g/mol. Its IUPAC name is N-[4-chloro-2-[(E)-N-(2-methoxyethoxy)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoro-N-prop-2-ynylmethanesulfonamide.
| Compound Name | N-[4-chloro-2-[(E)-N-(2-methoxyethoxy)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoro-N-prop-2-ynylmethanesulfonamide |
|---|---|
| PubChem CID | 59021136 |
| Molecular Formula | C15H16ClF3N2O4S |
| Molecular Weight | 412.82 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | N-[4-chloro-2-[(E)-N-(2-methoxyethoxy)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoro-N-prop-2-ynylmethanesulfonamide |
| SMILES | C#CCN(c1ccc(Cl)cc1/C(C)=N/OCCOC)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H16ClF3N2O4S/c1-4-7-21(26(22,23)15(17,18)19)14-6-5-12(16)10-13(14)11(2)20-25-9-8-24-3/h1,5-6,10H,7-9H2,2-3H3/b20-11+ |
| InChIKey | WXTQOERVFNMOOP-RGVLZGJSSA-N |
| XLogP | 3.02 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|