C19H21N3O — CID 59023481
2,2-dideuterio-N,N-bis(trideuteriomethyl)-2-[5,7,8-trideuterio-6-methyl-2-(2,3,5,6-tetradeuterio-4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetamide (PubChem CID 59023481) has the molecular formula C19H21N3O and a molecular weight of 322.49 g/mol. Its IUPAC name is 2,2-dideuterio-N,N-bis(trideuteriomethyl)-2-[5,7,8-trideuterio-6-methyl-2-(2,3,5,6-tetradeuterio-4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetamide.
| Compound Name | 2,2-dideuterio-N,N-bis(trideuteriomethyl)-2-[5,7,8-trideuterio-6-methyl-2-(2,3,5,6-tetradeuterio-4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 59023481 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | 2,2-dideuterio-N,N-bis(trideuteriomethyl)-2-[5,7,8-trideuterio-6-methyl-2-(2,3,5,6-tetradeuterio-4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetamide |
| SMILES | [2H]c1c([2H])c(-c2nc3c([2H])c([2H])c(C)c([2H])n3c2C([2H])([2H])C(=O)N(C([2H])([2H])[2H])C([2H])([2H])[2H])c([2H])c([2H])c1C |
| InChI | InChI=1S/C19H21N3O/c1-13-5-8-15(9-6-13)19-16(11-18(23)21(3)4)22-12-14(2)7-10-17(22)20-19/h5-10,12H,11H2,1-4H3/i3D3,4D3,5D,6D,7D,8D,9D,10D,11D2,12D |
| InChIKey | ZAFYATHCZYHLPB-YCYZLCDPSA-N |
| XLogP | 3.25 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |