C12H10N4 — CID 59023862
5-pyridin-3-yl-1H-indazol-3-amine (PubChem CID 59023862) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-pyridin-3-yl-1H-indazol-3-amine.
| Compound Name | 5-pyridin-3-yl-1H-indazol-3-amine |
|---|---|
| PubChem CID | 59023862 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 5-pyridin-3-yl-1H-indazol-3-amine |
| SMILES | Nc1n[nH]c2ccc(-c3cccnc3)cc12 |
| InChI | InChI=1S/C12H10N4/c13-12-10-6-8(3-4-11(10)15-16-12)9-2-1-5-14-7-9/h1-7H,(H3,13,15,16) |
| InChIKey | YRQFMGQEYZAZOZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |