About N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide
N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 59024307) has the molecular formula C20H16N4O3S2
and a molecular weight of 424.51 g/mol. Its IUPAC name is N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| PubChem CID | 59024307 |
| Molecular Formula | C20H16N4O3S2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1cc(-c2cc3ccccc3s2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C20H16N4O3S2/c1-11-20(12(2)27-23-11)29(25,26)24-15-7-14-10-21-22-19(14)16(9-15)18-8-13-5-3-4-6-17(13)28-18/h3-10,24H,1-2H3,(H,21,22) |
| InChIKey | XRCIHOFWIQKRJC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The IUPAC name of N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (CID 59024307) is N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The canonical SMILES for N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide is Cc1noc(C)c1S(=O)(=O)Nc1cc(-c2cc3ccccc3s2)c2[nH]ncc2c1.
What is the InChIKey of N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The InChIKey is XRCIHOFWIQKRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O3S2/c1-11-20(12(2)27-23-11)29(25,26)24-15-7-14-10-21-22-19(14)16(9-15)18-8-13-5-3-4-6-17(13)28-18/h3-10,24H,1-2H3,(H,21,22).
What are the key properties of N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide has a molecular weight of 424.51 g/mol, XLogP of 4.85, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 59024307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).