C6H6ClF7 — CID 59024458
5-chloro-1,1,1,2-tetrafluoro-2-(trifluoromethyl)pentane (PubChem CID 59024458) has the molecular formula C6H6ClF7 and a molecular weight of 246.55 g/mol. Its IUPAC name is 5-chloro-1,1,1,2-tetrafluoro-2-(trifluoromethyl)pentane.
| Compound Name | 5-chloro-1,1,1,2-tetrafluoro-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 59024458 |
| Molecular Formula | C6H6ClF7 |
| Molecular Weight | 246.55 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 5-chloro-1,1,1,2-tetrafluoro-2-(trifluoromethyl)pentane |
| SMILES | FC(F)(F)C(F)(CCCCl)C(F)(F)F |
| InChI | InChI=1S/C6H6ClF7/c7-3-1-2-4(8,5(9,10)11)6(12,13)14/h1-3H2 |
| InChIKey | HCXLXUIDQHLJFA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|