C10H9F7O — CID 59024486
5-(1,1,1,2-tetrafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 59024486) has the molecular formula C10H9F7O and a molecular weight of 278.17 g/mol. Its IUPAC name is 5-(1,1,1,2-tetrafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(1,1,1,2-tetrafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 59024486 |
| Molecular Formula | C10H9F7O |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 5-(1,1,1,2-tetrafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | CC(F)(C1C2C=CC(O2)C1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F7O/c1-8(11,10(15,16)17)6-4-2-3-5(18-4)7(6)9(12,13)14/h2-7H,1H3 |
| InChIKey | VKFIPMPNAUYUGN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|