About 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile
3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile (PubChem CID 59024630) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile.
Molecular Properties
| Compound Name | 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile |
| PubChem CID | 59024630 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile |
| SMILES | CC(C#N)=CC1=C(O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C10H11NO4/c1-6(5-11)4-7-8(12)14-10(2,3)15-9(7)13/h4,12H,1-3H3 |
| InChIKey | GEJTVECBOMYUTK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile?
The IUPAC name of 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile (CID 59024630) is 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile.
What is the SMILES notation for 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile?
The canonical SMILES for 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile is CC(C#N)=CC1=C(O)OC(C)(C)OC1=O.
What is the InChIKey of 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile?
The InChIKey is GEJTVECBOMYUTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4/c1-6(5-11)4-7-8(12)14-10(2,3)15-9(7)13/h4,12H,1-3H3.
What are the key properties of 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile?
3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile has a molecular weight of 209.20 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxin-5-yl)-2-methylprop-2-enenitrile is sourced from PubChem (CID 59024630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).