C10H14ClNOPS+ — CID 59024918
(4S,5R)-2-chloro-3,4-dimethyl-5-phenyl-2-sulfanyl-1,3,2-oxazaphospholidin-2-ium (PubChem CID 59024918) has the molecular formula C10H14ClNOPS+ and a molecular weight of 262.72 g/mol. Its IUPAC name is (4S,5R)-2-chloro-3,4-dimethyl-5-phenyl-2-sulfanyl-1,3,2-oxazaphospholidin-2-ium.
| Compound Name | (4S,5R)-2-chloro-3,4-dimethyl-5-phenyl-2-sulfanyl-1,3,2-oxazaphospholidin-2-ium |
|---|---|
| PubChem CID | 59024918 |
| Molecular Formula | C10H14ClNOPS+ |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (4S,5R)-2-chloro-3,4-dimethyl-5-phenyl-2-sulfanyl-1,3,2-oxazaphospholidin-2-ium |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[P+](S)(Cl)N1C |
| InChI | InChI=1S/C10H14ClNOPS/c1-8-10(9-6-4-3-5-7-9)13-14(11,15)12(8)2/h3-8,10,15H,1-2H3/q+1/t8-,10-,14?/m0/s1 |
| InChIKey | CVJJIOMJZMXUME-MYWFGVANSA-N |
| XLogP | 3.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|